Sucrose acetoisobutyrate (SAIB) is an emulsifier and has E number E444.[1] In the United States, SAIB is categorized as generally recognized as safe (GRAS) as a food additive in cocktail mixers, beer, malt beverages, or wine coolers[2] and is a potential replacement for brominated vegetable oil.
Quick facts Names, Identifiers ...
Sucrose acetate isobutyrate
 |
| Names |
| IUPAC name
1-O-Acetyl-3,4,6-tris-O-[(2-methylpropanoyl)oxy]-β-D-fructofuranosyl α-D-glucopyranoside 6-acetate 2,3,4-tris(2-methylpropanoate) |
Systematic IUPAC name
(2R,3R,4S,5R,6R)-2-[(Acetyloxy)methyl]-6-{{#parsoidfragment:0}}{[(2S,3S,4R,5R)-2-[(acetyloxy)methyl]-3,4-bis[(2-methylpropanoyl)oxy]-5-{{#parsoidfragment:1}}{[(2-methylpropanoyl)oxy]methyl}oxolan-2-yl]oxy}oxane-3,4,5-triyl tris(2-methylpropanoate) |
| Other names
Sucrose acetoisobutyrate Sucrose diacetate hexaisobutyrate HSDB 5657; AI3-25354; E444 |
| Identifiers |
|
|
|
|
| Abbreviations |
SAIB |
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.004.338 |
| EC Number |
|
| E number |
E444 (thickeners, ...) |
|
|
| UNII |
|
|
|
InChI=1S/C40H62O19/c1-18(2)33(43)50-16-27-29(54-35(45)20(5)6)32(57-38(48)23(11)12)40(58-27,17-51-25(14)42)59-39-31(56-37(47)22(9)10)30(55-36(46)21(7)8)28(53-34(44)19(3)4)26(52-39)15-49-24(13)41/h18-23,26-32,39H,15-17H2,1-14H3/t26-,27-,28-,29-,30+,31-,32+,39-,40+/m1/s1 Key: UVGUPMLLGBCFEJ-SWTLDUCYSA-N
|
CC(C)C(=O)OC[C@@H]1[C@H]([C@@H]([C@](O1)(COC(=O)C)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C
|
| Properties |
|
C40H62O19 |
| Molar mass |
846.917 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close