Sulisobenzone (benzophenone-4) is an ingredient in some sunscreens which protects the skin from damage by UVB and UVA ultraviolet light.[2][3]
Quick facts Names, Identifiers ...
Sulisobenzone[1]
 |
 |
| Names |
Preferred IUPAC name
5-Benzoyl-4-hydroxy-2-methoxybenzene-1-sulfonic acid |
| Other names
Benzophenone-4 |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.021.612 |
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19) Y Key: CXVGEDCSTKKODG-UHFFFAOYSA-N Y InChI=1/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19) Key: CXVGEDCSTKKODG-UHFFFAOYAQ
|
O=S(=O)(O)c1cc(c(O)cc1OC)C(=O)c2ccccc2
|
| Properties |
|
C14H12O6S |
| Molar mass |
308.31 g/mol |
| Appearance |
Light-tan powder |
| Melting point |
145 °C (293 °F; 418 K) |
|
1 g per 4 mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Its sodium salt, sulisobenzone sodium, is also referred to as benzophenone-5.