Tetraphenylene is an organic compound, solid at room temperature, with the chemical formula C24H16. It is a member of the unsaturated polycyclic hydrocarbons class of compounds and a tetramer of benzyne.
Quick facts Names, Identifiers ...
Tetraphenylene[1]
 Skeletal formula |
 Space-filling model |
| Names |
| Preferred IUPAC name
|
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
InChI=1S/C24H16/c1-2-10-18-17(9-1)19-11-3-4-13-21(19)23-15-7-8-16-24(23)22-14-6-5-12-20(18)22/h1-16H/b19-17-,20-18-,23-21-,24-22- N Key: KTQYWNARBMKMCX-LEYBOLSUSA-N N
|
C1=CC=C2C(=C1)C3=CC=CC=C3C4=CC=CC=C4C5=CC=CC=C25
|
| Properties |
|
C24H16 |
| Molar mass |
304.39 g/mol |
| Density |
1.19 g/cm3 |
| Melting point |
232 to 235 °C (450 to 455 °F; 505 to 508 K) |
| Boiling point |
577.6 °C (1,071.7 °F; 850.8 K) at 760 mmHg |
| Hazards |
| Flash point |
297.9 °C (568.2 °F; 571.0 K) |
| Structure |
|
D2d |
|
0 D |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
