Tetraphlorethol C is a phlorethol-type phlorotannin found in the brown alga Ascophyllum nodosum.[1] Chemically, it is a tetramer of 1,2,3,5-tetrahydroxybenzene.
Quick facts Names, Identifiers ...
Tetraphlorethol C
 |
Names |
Preferred IUPAC name
2,4,6-Trioxa-1,7(1),3,5(1,4)-tetrabenzenaheptaphane-12,14,16,33,35,53,55,73,75-nonol |
Other names
2-[4-[4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]-3,5-dihydroxyphenoxy]benzene-1,3,5-triol |
Identifiers |
|
|
ChemSpider |
|
|
|
|
|
InChI=1S/C24H18O12/c25-10-1-11(26)3-13(2-10)34-23-18(30)8-15(9-19(23)31)36-24-20(32)6-14(7-21(24)33)35-22-16(28)4-12(27)5-17(22)29/h1-9,25-33H Key: YOFARVUPGKULPN-UHFFFAOYSA-N
|
c4c(O)cc(O)cc4Oc1c(O)cc(cc1O)Oc3c(O)cc(cc3O)Oc2c(O)cc(O)cc2O
|
Properties |
|
C24H18O12 |
Molar mass |
498.396 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close