Thiocarbohydrazide is a toxic compound made by the reaction of carbon disulfide with hydrazine (hydrazinolysis). It is used in the silver proteinate specific staining of carbohydrates in electron microscopy.
Quick facts Names, Identifiers ...
Thiocarbohydrazide
 |
| Names |
Preferred IUPAC name
Hydrazinecarbothiohydrazide [1] |
| Other names
1,3-Diamino-2-thiourea; Thiocarbazide; Thiocarbonic dihydrazide; Thiocarbonyldihydrazide; Carbonothioic dihydrazide; TCh; Thiocarbonohydrazide |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.017.064 |
|
|
| UNII |
|
|
|
InChI=1S/CH6N4S/c2-4-1(6)5-3/h2-3H2,(H2,4,5,6) Key: LJTFFORYSFGNCT-UHFFFAOYSA-N InChI=1/CH6N4S/c2-4-1(6)5-3/h2-3H2,(H2,4,5,6) Key: LJTFFORYSFGNCT-UHFFFAOYAM
|
|
| Properties |
|
CH6N4S |
| Molar mass |
106.15 g·mol−1 |
| Melting point |
171 to 174 °C (340 to 345 °F; 444 to 447 K) (decomposes)[2] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close