Tioxolone (INN, also spelled thioxolone) is an anti-acne preparation.[1]
| This article needs additional citations for verification. (November 2023) |
Quick facts Names, Identifiers ...
Tioxolone
 |
| Names |
Preferred IUPAC name
6-Hydroxy-2H-1,3-benzoxathiol-2-one |
| Identifiers |
|
|
|
|
|
136261 |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| DrugBank |
|
| ECHA InfoCard |
100.023.321 |
| EC Number |
|
| KEGG |
|
|
|
| RTECS number |
|
| UNII |
|
|
|
InChI=1S/C7H4O3S/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3,8H N Key: SLYPOVJCSQHITR-UHFFFAOYSA-N N InChI=1/C7H4O3S/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3,8H Key: SLYPOVJCSQHITR-UHFFFAOYAC
|
|
| Properties |
|
C7H4O3S |
| Molar mass |
168.16986 |
| Melting point |
158 to 160 °C (316 to 320 °F; 431 to 433 K) |
| Pharmacology |
|
D10AB03 (WHO) |
| Hazards |
| GHS labelling: |
|
 |
|
Warning |
|
H302, H315, H319, H335 |
|
P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close