Trifolin is a chemical compound. It is the kaempferol 3-galactoside. It can be found in Camptotheca acuminata,[1] in Euphorbia condylocarpa[2] or in Consolida oliveriana.[3]
Quick facts Names, Identifiers ...
Trifolin
Trifolin structure |
| Names |
| IUPAC name
3-(β-D-Galactopyranosyloxy)-4′,5,7-trihydroxyflavone |
Systematic IUPAC name
5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-1-benzopyran-4-one |
| Other names
Kaempferol 3-O-β-D-galactoside Kaempferol-3-O-galactoside |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15+,17+,18-,21+/m1/s1 Key: JPUKWEQWGBDDQB-DTGCRPNFSA-N
|
C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O
|
| Properties |
|
C21H20O11 |
| Molar mass |
448.37 g/mol |
| Density |
1.791 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Kaempferol 3-O-galactosyltransferase is an enzyme that catalyzes the chemical reaction:
UDP-galactose + kaempferol → UDP + kaempferol 3-O-beta-D-galactoside (trifolin).[4] It can also be found in seedlings of Vigna mungo.[5]