This article is about the chemical compound. For the Triformin brand of diabetes medication, see
Metformin § Formulations.
Triformin (glycerin triformate) is the triester of glycerol and formic acid.
Quick facts Names, Identifiers ...
Triformin
 |
 |
| Names |
Systematic IUPAC name
Propane-1,2,3-triyl triformate |
Other names
- Propane-1,2,3-triol triformate
- 1,2,3-Propanetriol, 1,2,3-triformate
- Glycerol triformate
- Glycerin triformate
- 2,3-Diformyloxypropyl formate
|
| Identifiers |
|
|
|
|
|
1769884 |
| ChemSpider |
|
| ECHA InfoCard |
100.109.163 |
|
|
| UNII |
|
|
|
InChI=1S/C6H8O6/c7-3-10-1-6(12-5-9)2-11-4-8/h3-6H,1-2H2 Key: UFTFJSFQGQCHQW-UHFFFAOYSA-N
|
|
| Properties |
|
C6H8O6 |
| Molar mass |
176.124 g·mol−1 |
| Density |
1.32 g/cm3 |
| Melting point |
18 °C (64 °F; 291 K)[1] |
| Boiling point |
266 °C (511 °F; 539 K)[1] |
|
1.4412 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close