Vernolepin is a sesquiterpene lactone isolated from the dried fruit of Vernonia amygdalina. It shows platelet anti-aggregating properties[2] and is also an irreversible DNA polymerase inhibitor,[3] hence may have antitumor properties.
Quick facts Names, Identifiers ...
Vernolepin
 |
| Names |
Preferred IUPAC name
(3aR,4S,5aR,9aR,9bR)-5a-Ethenyl-4-hydroxy-3,9-dimethylideneoctahydro-2H-furo[2,3-f][2]benzopyran-2,8(3H)-dione |
| Other names
Vernolepin |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C15H16O5/c1-4-15-5-9(16)10-7(2)14(18)20-12(10)11(15)8(3)13(17)19-6-15/h4,9-12,16H,1-3,5-6H2/t9-,10+,11+,12-,15+/m0/s1 Key: IFYQXAXVZGMFNW-MVIRXUPPSA-N InChI=1/C15H16O5/c1-4-15-5-9(16)10-7(2)14(18)20-12(10)11(15)8(3)13(17)19-6-15/h4,9-12,16H,1-3,5-6H2/t9-,10+,11+,12-,15+/m0/s1 Key: IFYQXAXVZGMFNW-MVIRXUPPBC
|
C=C[C@]12C[C@@H]([C@@H]3[C@@H]([C@H]1C(=C)C(=O)OC2)OC(=O)C3=C)O
|
| Properties |
|
C15H16O5 |
| Melting point |
179 to 180 °C (354 to 356 °F; 452 to 453 K)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close