Wighteone is an isoflavone, a type of flavonoid. It can be found in Maclura aurantiaca, the hedge apple.[1]
Quick facts Names, Identifiers ...
Wighteone
 |
| Names |
| IUPAC name
4′,5,7-Trihydroxy-6-(3-methylbut-2-en-1-yl)isoflavone |
Systematic IUPAC name
5,7-Dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one |
| Other names
6-Isopentenylgenistein 6-Prenyl-5,7,4′-trihydroxyisoflavone |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 N Key: KIMDVVKVNNSHGZ-UHFFFAOYSA-N N InChI=1/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 Key: KIMDVVKVNNSHGZ-UHFFFAOYAL
|
CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)O)C
|
| Properties |
|
C20H18O5 |
| Molar mass |
338.359 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close