|
|
 |
| အမည် |
| IUPAC name
Trichloromethane |
| အခြားအမည်များ
Trichloromethane; formyl trichloride; methane trichloride; methyl trichloride; methenyl trichloride; TCM; freon 20; refrigerant-20; R-20; UN 1888 |
| အမှတ်အသားများ-->
-->
-->
-->
----- templatepar -----
--> |
CAS Number |
67-66-3 Y |
| ChEBI |
CHEBI:35255 Y |
| ChEMBL |
ChEMBL44618 Y |
| ChemSpider |
5977 Y |
| EC Number |
200-663-8 |
| Jmol 3D model |
Interactive image |
| KEGG |
C13827 Y |
| PubChem |
6212 |
| RTECS number |
FS9100000 |
| UNII |
7V31YC746X Y |
InChI
InChI=1S/CHCl3/c2-1(3)4/h1H Y Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Y InChI=1/CHCl3/c2-1(3)4/h1H Key: HEDRZPFGACZZDS-UHFFFAOYAG
|
|
| ဂုဏ်သတ္တိများ |
|
CHCl3 |
| Molar mass |
၁၁၉.၃၇ g·mol−1 |
| ရုပ်အဆင်း |
Colorless liquid |
| အနံ့ |
Heavy, ethereal odor |
| သိပ်သည်းမှု |
1.564 g/cm3 (-20 °C)
1.489 g/cm3 (25 °C)
1.394 g/cm3 (60 °C) |
| အရည်ပျော်မှတ် |
−၆၃.၅ ဒီဂရီ စင်တီဂရိတ် (−၈၂.၃ ဒီဂရီ ဖာရင်ဟိုက်; ၂၀၉.၇ ကယ်လ်ဗင်) |
| ရေဆူမှတ် |
၆၁.၁၅ ဒီဂရီ စင်တီဂရိတ် (၁၄၂.၀၇ ဒီဂရီ ဖာရင်ဟိုက်; ၃၃၄.၃၀ ကယ်လ်ဗင်) |
ရေထဲပျော်ဝင်မှု |
1.062 g/100 mL (0 °C)
0.809 g/100 mL (20 °C)
0.732 g/100 mL (60 °C) |
| ပျော်ဝင်မှု |
Soluble in benzene
Miscible in diethyl ether, oils, ligroin, alcohol, CCl4, CS2 |
| ပျော်ဝင်မှု in acetone |
≥ 10 g/100 mL (19 °C) |
| ပျော်ဝင်မှု in dimethyl sulfoxide |
≥ 10 g/100 mL (19 °C) |
| ရေငွေ့ ဖိအား |
0.62 kPa (-40 °C)
7.89 kPa (0 °C)
25.9 kPa (25 °C)
313 kPa (100 °C)
2.26 MPa (200 °C) |
Henry's law
ကိန်းသေ (kH) |
3.67 L·atm/mol (24 °C) |
| အက်စစ် ပါဝင်မှု (pKa) |
15.7 (20 °C) |
| အပူ စီးကူးမှု |
0.13 W/m·K (20 °C) |
Refractive index (nD) |
1.4459 (20 °C) |
| ပျစ်စေးမှု |
0.563 cP (20 °C) |
| တည်ဆောက်ပုံ |
Molecular shape |
Tetrahedral |
Dipole moment |
1.15 D |
| သာမိုဓာတုဗေဒ |
Specific
heat capacity (C) |
114.25 J/mol·K |
Std molar
အင်ထရိုပီ (So298) |
202.9 J/mol·K |
Std enthalpy of
formation (ΔfHo298) |
-134.3 kJ/mol |
Gibbs free energy (ΔfG˚) |
-71.1 kJ/mol |
Std enthalpy of
combustion (ΔcHo298) |
473.21 kJ/mol |
| အန္တရာယ် |
| GHS pictograms |
  |
| GHS signal word |
Warning |
GHS hazard statements |
H302, H315, H319, H332, H336, H351, H361, H373 |
GHS precautionary statements |
P261, P281, P305+351+338 |
EU classification (DSD) |
 Xn Xi
Carc. Cat. 2B |
| R-phrases |
တမ်းပလိတ်:R22, တမ်းပလိတ်:R38, တမ်းပလိတ်:R40, တမ်းပလိတ်:R48/20/22 |
| S-phrases |
(S2), တမ်းပလိတ်:S36/37 |
| NFPA 704 |
|
| Flash point |
Non-flammable |
| Lethal dose or concentration (LD, LC): |
LD50 (median dose) |
1250 mg/kg (rats, oral) |
| US health exposure limits (NIOSH): |
|
50 ppm (240 mg/m3) (OSHA) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Y verify (what is YN ?) |
| Infobox references |
|
|
