Lactose is a disaccharide succar derived frae galactose an glucose that is foond in milk. Lactose maks up aroond 2~8% o milk (bi wicht), altho the amoont varies amang species an individuals. It is extractit frae sweet or sour whey. The name comes frae lac or lactis, the Latin wird for milk, plus the -ose endin uised tae name succars. It haes a formula o C12H22O11.
Quick facts Names, Identifiers ...
Lactose (Milk succar)
 |
Names |
IUPAC name
β-D-galactopyranosyl-(1→4)-D-glucose |
Ither names
Milk succar 4-O-β-D-galactopyranosyl-D-glucose |
Identifiers |
CAS Nummer |
|
3D model (JSmol) |
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
|
|
UNII |
|
InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 Y Key: GUBGYTABKSRVRQ-DCSYEGIMSA-N Y InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 Key: GUBGYTABKSRVRQ-DCSYEGIMBP
|
SMILES
C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O
|
Properties |
|
C12H22O11 |
Molar mass |
342.30 g/mol |
Appearance |
white solid |
Density |
1.525 g/cm3 |
Meltin pynt |
202.8 °C[1] |
Bylin pynt |
668.9 °C[1] |
Solubility in watter |
21.6 g/100 mL[2] |
Thermochemistry |
Std enthalpy o combustion ΔcHo298 |
5652 kJ/mol, 1351 kcal/mol, 16.5 kJ/g, 3.94 kcal/g |
Hazards |
NFPA 704 |
|
Flash pynt |
357.8 °C[1] |
Except whaur itherwise notit, data are gien for materials in thair staundart state (at 25 °C [77 °F], 100 kPa). |
Y verify (whit is YN ?) |
Infobox references |
|
|
Close