Nitroglycerin (NG), forby kent as nitroglycerine, trinitroglycerin, trinitroglycerine, or nitro, or mair correctly as glyceryl trinitrate, or mair formally as 1,2,3-trinitroxypropane, is a hivy, colourless, ily, explosive liquid maist commonly produced bi treatin glycerol wi white fumin nitric acid unner condeetions appropriate tae the formation o the nitric acid ester.
Quick facts Names, Identifiers ...
Nitroglycerin
 |
 |
 |
| Names |
| IUPAC name
1,2,3-Trinitroxypropane |
Seestematic IUPAC name
2,3-Bis(nitrooxy)propyl nitrate |
| Ither names
1,3-Dinitrooxypropan-2-yl nitrate
Propane-1,2,3-triyl trinitrate |
| Identifiers |
CAS Nummer |
|
3D model (JSmol) |
|
Beilstein Reference |
1802063 |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| DrugBank |
|
| EC Nummer |
200-240-8 |
| Gmelin Reference |
165859 |
| KEGG |
|
| MeSH |
Nitroglycerin |
|
|
| UNII |
|
| UN nummer |
0143, 0144, 1204, 3064, 3319 |
InChI=1S/C3H5N3O9/c7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3H,1-2H2 Y Key: SNIOPGDIGTZGOP-UHFFFAOYSA-N Y InChI=1/C3H5N3O9/c7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3H,1-2H2 Key: SNIOPGDIGTZGOP-UHFFFAOYAR
|
SMILES
o:n(:o)OCC(COn(:o):o)On(:o):o C(C(CO[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-]
|
| Properties |
|
C3H5N3O9 |
| Molar mass |
227.09 g·mol−1 |
| Appearance |
Colourless liquid |
| Density |
1.6 g cm−3 (at 15 °C) |
| Meltin pynt |
14 °C (57 °F; 287 K) |
| Bylin pynt |
50 °C (122 °F; 323 K) |
Solubility in watter |
slichtly[1] |
| Solubility |
acetone, ether, benzene, alcohol[1] |
| log P |
2.154 |
| Structur |
Coordination geometry |
Tetragonal at C1, C2, an C3
Trigonal planar at N7, N8, an N9 |
| Molecular shape |
Tetrahedral at C1, C2, an C3
Dihedral at N7, N8, and N9 |
| Thermochemistry |
Std enthalpy o
formation ΔfHo298 |
−370 kJ mol−1 |
Std enthalpy o
combustion ΔcHo298 |
−1.529 MJ mol−1 |
| Pharmacology |
Routes o
admeenistration |
Intravenous, Oral, Sublingual, Topical, Transdermal |
| Pharmacokinetics: |
Bioavailability |
<1% |
Metabolism |
Hepatic |
Biological hauf-life |
3 min |
| Legal status |
|
| Explosive data |
| Shock sensitivity |
Heich |
| Friction sensitivity |
Heich |
| RE factor |
1.50 |
| Hazards |
| EU clessification |
 E  T+  N |
| R-phrases |
R3, R12, R26/27/28, R33, R51/53 |
| S-phrases |
(S1/2), S33, S35, S36/37, S45, S53, S61 |
| NFPA 704 |
|
Except whaur itherwise notit, data are gien for materials in thair staundart state (at 25 °C [77 °F], 100 kPa). |
| Y verify (whit is YN ?) |
| Infobox references |
|
|
Close
