Quetiapine (better known as Seroquel) is an antipsychotic drug used to treat bipolar disorder and unipolar major depression, though it is used off-label for anxiety problems, Tourette syndrome and autism issues. The side effects of Quetiapine include fatigue, dry mouth and being sleepy. The medication is sometimes used for PTSD.
Quick facts Clinical data, Pronunciation ...
Quetiapine |
 |
|
| Pronunciation | kwi-TY-ə-peen |
|---|
| Trade names | Seroquel, Temprolide, others |
|---|
| AHFS/Drugs.com | Monograph |
|---|
| MedlinePlus | a698019 |
|---|
| License data |
|
|---|
Pregnancy
category | |
|---|
Routes of
administration | By mouth |
|---|
| ATC code | |
|---|
|
| Legal status |
- AU: S4 (Prescription only)
- CA: ℞-only
- UK: POM (Prescription only)
- US: ℞-only
|
|---|
|
| Bioavailability | 100%[1] |
|---|
| Protein binding | 83%[2] |
|---|
| Metabolism | Liver via CYP3A4-catalysed sulfoxidation to its active metabolite norquetiapine (N-desalkylquetiapine)[3] |
|---|
| Elimination half-life | 7 hours (parent compound); 9–12 hours (active metabolite, norquetiapine)[2][4] |
|---|
| Excretion | Kidney (73%), faeces (20%)[1][2][4][5] |
|---|
|
2-(2-(4-Dibenzo[b,f][1,4]thiazepine-11-yl-1-piperazinyl)ethoxy)ethanol
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| IUPHAR/BPS | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEBI | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.131.193 |
|---|
|
| Formula | C21H25N3O2S |
|---|
| Molar mass | 383.5099 g/mol |
|---|
| 3D model (JSmol) | |
|---|
| Solubility in water | 3.29 mg/mL (20 °C) |
|---|
N\1=C(\c3c(Sc2c/1cccc2)cccc3)N4CCN(CCOCCO)CC4
|
InChI=1S/C21H25N3O2S/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21/h1-8,25H,9-16H2 Y Key:URKOMYMAXPYINW-UHFFFAOYSA-N Y
|
| (verify) |
Close
