Not to be confused with Retinol.
This article is about the molecule. For the anatomical feature, see
Retina.
Retinal (also known as Retinaldehyde) is a hydrocarbon belonging to the aldehyde group. It is commonly used as a skincare product.
Quick facts Names, Identifiers ...
All-trans-retinal
 |
 |
| Names |
| IUPAC name
Retinal |
Systematic IUPAC name
(2E,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal |
Other names
- Retinene
- Retinaldehyde
- Vitamin A aldehyde
- RAL
|
| Identifiers |
|
|
3D model (JSmol) |
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.003.760 |
|
|
| UNII |
|
|
|
|
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=O)/C)/C
|
| Properties |
|
C20H28O |
| Molar mass |
284.44 g·mol−1 |
| Appearance |
Orange crystals from petroleum ether[1] |
| Melting point |
61 to 64 °C (142 to 147 °F; 334 to 337 K)[1] |
|
Nearly insoluble |
| Solubility in fat |
Soluble |
| Related compounds |
| Related compounds |
{{{value}}} |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
Close