Astringin is a stilbenoid, the 3-β-D-glucoside of piceatannol.[1] It can be found in the bark of Picea sitchensis[2][3] and Picea abies (Norway spruce).[4]
Quick Facts Names, Identifiers ...
Astringin
 Chemical structure of astringin |
| Names |
| IUPAC name
3-[(E)-2-(2,3-Dihydroxyphenyl)ethen-1-yl]-5-hydroxyphenyl β-D-glucopyranoside |
Systematic IUPAC name
(2S,3R,4S,5S,6R)-2-{3-[(E)-2-(3,4-Dihydroxyphenyl)ethen-1-yl]-5-hydroxyphenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-13-6-11(5-12(22)8-13)2-1-10-3-4-14(23)15(24)7-10/h1-8,16-27H,9H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1 Y Key: PERPNFLGJXUDDW-CUYWLFDKSA-N Y InChI=1/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-13-6-11(5-12(22)8-13)2-1-10-3-4-14(23)15(24)7-10/h1-8,16-27H,9H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1 Key: PERPNFLGJXUDDW-CUYWLFDKBH
|
O(c2cc(O)cc(\C=C\c1ccc(O)c(O)c1)c2)[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO
|
| Properties |
|
C20H22O9 |
| Molar mass |
406.387 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
It is also present in Vitis vinifera cells cultures[5] and in wine.[6]
