Ovalene is a polycyclic aromatic hydrocarbon with the formula C32H14, which consists of ten peri-fused six-membered rings. It is very similar to coronene.
Quick facts Names, Identifiers ...
Ovalene
 |
 |
| Names |
| Preferred IUPAC name
|
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.005.347 |
| EC Number |
|
|
|
| UNII |
|
|
|
InChI=1S/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H N Key: LSQODMMMSXHVCN-UHFFFAOYSA-N N InChI=1/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H Key: LSQODMMMSXHVCN-UHFFFAOYAN
|
c1cc2c3c4c1ccc5cc6c7c8c(ccc9=c8c1c(cc9)cc(c3c1c7c54)cc2)cc6
|
| Properties |
|
C32H14 |
| Molar mass |
398.45 g/mol |
| Density |
1.496 g/cm3[2] |
| Melting point |
473 °C (883 °F; 746 K)[2] |
|
−353.8·10−6 cm3/mol[3] |
| Structure[2] |
|
monoclinic, P21/a |
|
a = 1.947(5) nm, b = 0.470(1) nm, c = 1.012(4) nm α = 90°, β = 105.0(3)°, γ = 90° |
|
2 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Ovalene is a reddish-orange compound. It is sparingly soluble in solvents such as benzene, toluene, and dichloromethane. Its solutions have a green fluorescence under UV light.
Ovalene has been shown to form in deep-sea hydrothermal vent areas and in the hydrocracking process of petroleum refining.