Potassium trispyrazolylborate

Potassium trispyrazolylborate, commonly abbreviated KTp, is the potassium salt with the formula :KHB(C₃N₂H₃)₃. This salt is the source of the trispyrazolylborate ligand.^[1]

Potassium trispyrazolylborate

Names
Preferred IUPAC name Potassium tri(1H-pyrazol-1-yl)boranuide
Identifiers
CAS Number	18583-60-3 Y
3D model (JSmol)	Interactive image Interactive image
ChemSpider	2007131 N
ECHA InfoCard	100.203.487
PubChem CID	2725019
CompTox Dashboard (EPA)	DTXSID00635417
InChI InChI=1S/C9H10BN6.K/c1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;/h1-10H;/q-1;+1 N Key: IBNGZWIUPDMZMG-UHFFFAOYSA-N N InChI=1/C9H10BN6.K/c1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;/h1-10H;/q-1;+1 Key: IBNGZWIUPDMZMG-UHFFFAOYAZ
SMILES [H][B-](N1N=CC=C1)(N2N=CC=C2)N3N=CC=C3.[K+] [BH-](n1cccn1)(n2cccn2)n3cccn3.[K+]
Properties
Chemical formula	C9H10BKN6
Molar mass	252.13 g·mol−1
Melting point	188 to 189 °C (370 to 372 °F; 461 to 462 K)[1]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?) Infobox references

KTp is a white crystalline solid that is soluble in polar solvents, alcohols, and water. The synthesis of KTp involves potassium borohydride and pyrazole without a solvent.^[2]

KBH₄ + 3 C₃N₂H₄ → KHB(C₃N₂H₃)₃ + 3 H₂

Idealized structure of a Tp ligand bound to a metal center ML_n.

The tris(pyrazolyl)borate forms octahedral coordination compounds with the formula M[Tp]₂ with first row transition metals. KTp also forms 1:1 complexes, for example it can be converted to K[TpMo(CO)₃];

KTp + Mo(CO)₆→K[TpMo(CO)₃] + 3 CO

When K[TpMo(CO)₃] is treated with butyl nitrite it yields the neutral orange complex TpMo(CO)₂NO.^[3]

K[TpMo(CO)₃]+ BuONO→TpMo(CO)₂NO+CO+KOBu