Spirodiclofen is an acaricide and insecticide used in agriculture to control mites and San Jose scale. In the United States, it is used on citrus, grapes, pome fruit, stone fruit, and tree nut crops.[1][2][3]
Quick Facts Names, Identifiers ...
Spirodiclofen
 |
| Names |
Preferred IUPAC name
3-(2,4-Dichlorophenyl)-2-oxo-1-oxaspiro[4.5]non-3-en-4-yl 2,2-dimethylbutanoate |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.130.204 |
| EC Number |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H24Cl2O4/c1-4-20(2,3)19(25)26-17-16(13-10-14(22)12-15(23)11-13)18(24)27-21(17)8-6-5-7-9-21/h10-12H,4-9H2,1-3H3 Key: OYNVHVAEOLJJPV-UHFFFAOYSA-N
|
CCC(C)(C)C(=O)OC1=C(C(=O)OC12CCCCC2)c3cc(cc(c3)Cl)Cl
|
| Properties |
|
C21H24Cl2O4 |
| Molar mass |
411.32 g·mol−1 |
| Appearance |
White solid |
| Melting point |
94.8 °C (202.6 °F; 367.9 K)[1] |
| Hazards |
| GHS labelling: |
|
   |
|
Danger |
|
H317, H350, H361, H373, H410 |
|
P201, P202, P260, P261, P272, P273, P280, P281, P302+P352, P308+P313, P314, P321, P333+P313, P363, P391, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
Spirodiclofen belongs to the tetronic acid class and acts by inhibiting lipid biosynthesis, specifically acetyl CoA carboxylase, and is in IRAC group 23.[3][4]
