This article is about thymolphthalein. For other related dyes in the phthalein family, see
Phthalein dye.
Thymolphthalein is a phthalein dye used as an acid–base (pH) indicator. Its transition range is around pH 9.3–10.5. Below this pH, it is colorless; above, it is blue. The molar extinction coefficient for the blue thymolphthalein dianion is 38,000 M−1 cm−1 at 595 nm.[2]
Thymolphthalein (pH indicator) |
below pH 9.3 |
|
above pH 10.5 |
9.3 |
⇌ |
10.5 |
Quick Facts Names, Identifiers ...
Thymolphthalein
 |
Names |
Preferred IUPAC name
3,3-Bis[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-2-benzofuran-1(3H)-one |
Identifiers |
|
|
|
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.004.300 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 Y Key: LDKDGDIWEUUXSH-UHFFFAOYSA-N Y InChI=1/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 Key: LDKDGDIWEUUXSH-UHFFFAOYAV
|
O=C1OC(c2ccccc12)(c3cc(c(O)cc3C)C(C)C)c4cc(c(O)cc4C)C(C)C
|
Properties |
|
C28H30O4 |
Molar mass |
430.544 g·mol−1 |
Appearance |
White powder |
Melting point |
248 to 252 °C (478 to 486 °F; 521 to 525 K) (decomposes) |
Hazards[1] |
GHS labelling: |
|
 |
|
Warning |
|
H341, H350, H361 |
|
P201, P202, P210, P233, P240, P241, P242, P243, P280, P281, P303+P361+P353, P308+P313, P370+P378, P403+P235, P405, P501 |
NFPA 704 (fire diamond) |
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Thymolphthalein is also known to have use as a laxative[3] and for disappearing ink.[4]