Terbogrel (INN[1]) is an experimental drug that has been studied for its potential to prevent the vasoconstricting and platelet-aggregating action of thromboxanes. Terbogrel is an orally available thromboxane A2 receptor antagonist and a thromboxane A synthase inhibitor.[2][3] The drug was developed by Boehringer Ingelheim.
Quick facts Names, Identifiers ...
Terbogrel
 |
| Names |
| IUPAC name
(5E)-6-{3-[tert-Butyl(cyano)carbamimidamido]phenyl}-6-pyridin-3-ylhex-5-enoic acid |
| Other names
(5E)-6-[m-(3-tert-Butyl-2-cyanoguanidino)phenyl]-6-(3-pyridyl)-5-hexenoic acid |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
InChI=1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ Y Key: XUTLOCQNGLJNSA-RGVLZGJSSA-N Y InChI=1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+
|
N#CN\C(=N/C(C)(C)C)Nc2cccc(C(=C/CCCC(=O)O)\c1cccnc1)c2
|
| Properties |
|
C23H27N5O2 |
| Molar mass |
405.502 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
A phase 2 clinical trial of terbogrel was discontinued due to its induction of leg pain.[4]